Sugar alcohols
Medchemexpress LLC 3'-Azido-3'-deoxy-beta-L-uridine | 2095417-28-8 | 98.8% | 269.21 | 100 MG
3'-Azido-3'-deoxy-beta-L-uridine is a nucleoside derivative that functions as a click chemistry reagent. It contains an azide group, allowing it to participate in various cycloaddition reactions.
- Functions as a click chemistry reagent
- Contains an azide group
- Enables participation in copper-catalyzed azide-alkyne cycloaddition reactions (CuAAc) with molecules containing alkyne groups
- Engages in strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules possessing DBCO or BCN groups
Alkali Scientific Glycerol, USP Grade, 4 L
Glycerol, USP Grade, 4 L, is a highly purified laboratory-grade humectant widely used in chemical and biochemical research. It is essential in maintaining moisture balance in various products, including cosmetics, pharmaceuticals, and biological solutions. In research, glycerol is used in cryopreservation to safeguard cells and tissues against ice damage during freezing. It is also used in buffer solutions, enhancing the stability and functionality of proteins and enzymes. As a humectant, it attracts and retains moisture, preventing dryness and degradation in formulations. This product meets the USP standards for purity, ensuring its reliability in sensitive laboratory and industrial applications.
![eMolecules 41107-82-8 | 2,5-Anhydro-D-mannitol | Ambeed | MFCD00012443 | 164.157 | C6H12O5 | 90.000 | OC[C@H]1O[C@H](CO)[C@@H](O)[C@@H]1O | 1g | 599356535](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000163860.jpg-250.jpg)
eMolecules 41107-82-8 | 2,5-Anhydro-D-mannitol | Ambeed | MFCD00012443 | 164.157 | C6H12O5 | 90.000 | OC[C@H]1O[C@H](CO)[C@@H](O)[C@@H]1O | 1g | 599356535
2,5-Anhydro-D-mannitol | Ambeed | 41107-82-8 | MFCD00012443 | 164.157 | C6H12O5 | 90.000 | OC[C@H]1O[C@H](CO)[C@@H](O)[C@@H]1O | 1g | 599356535